
Z Wikipedie, otevřené encyklopedie
Skočit na: Navigace, Hledání
Strukturní vzorec empenthrinu
Strukturní vzorec empenthrinu
Systematický název (E)-(RS)-1-ethynyl-2-methylpent-2-enyl (1RS,3RS;1RS,3SR)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyklopropankarboxylát
Triviální název empenthrin
Ostatní názvy vaporthrin, d-empenthrin
Anglický název Empenthrin
Sumární vzorec C18H26O2
Vzhled žlutá kapalina nebo pevná látka
Registrační číslo CAS
EC-no (EINECS/ELINCS/NLP) 259-154-4
UN kód 3082
SMILES C1([C@@H]([C@@H]1\C=C(/C)C)C(O[C@@H](\C(=C\CC)C)C#C)=O)(C)C
InChI 1/C18H26O2/c1-8-10-13(5)15(9-2)20-17(19)16-14(11-12(3)4)18(16,6)7/h2,10-11,14-16H,8H2,1,3-7H3/b13-10+
Molární hmotnost 274,40 g/mol
Teplota tání 25 °C
Teplota varu 295 °C
Hustota 0,927 g/cm³
Rozpustnost ve vodě 1,1 mg/100 ml
Zdraví škodlivý
Zdraví škodlivý (Xn)
Nebezpečný pro životní prostředí
Nebezpečný pro životní prostředí (N)
R-věty R22 R51/53
S-věty S61
Není-li uvedeno jinak, jsou použity jednotky
SI a STP (25 °C, 100 kPa).

Empenthrin (též nazývaný vaporthrin; podle IUPAC (E)-(RS)-1-ethynyl-2-methylpent-2-enyl (1RS,3RS;1RS,3SR)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyklopropankarboxylát) je syntetický pyrethroid používaný v insekticidech. Je účinný proti široké škále létajícího hmyzu, včetně molů a dalšího hmyzu poškozujícího textil.[1] Má nízkou akutní toxicitu pro savce (orální LD50 je nad 5 000 mg/kg pro potkany samce, nad 3500 mg/kg pro samice a více než 3 500 mg/kg pro myši).[2] Pro ryby a další vodní živočichy je vysoce toxický (96hodinová LC50 pro pstruha duhového je 1,7 μg·l−1, 48hodinová EC50 pro hrotnatku 20 μg·l−1).[1]

Přípravek s empenthrinem proti šatním molům

Reference[editovat | editovat zdroj]

  1. a b empenthrin (Ref: S 2852 Forte)
  2. Mammalian toxicity of empenthrin (Vaporthrin, S-2852F)