Kyselina trichlorfenoxyoctová

Z Wikipedie, otevřené encyklopedie
Skočit na: Navigace, Hledání
Kyselina trichlorfenoxyoctová
2,4,5-T.svg
Obecné
Systematický název Kyselina trichlorfenoxyethanová
Triviální název Kyselina trichlorfenoxyoctová
Anglický název Trichlorophenoxyacetic acid
Sumární vzorec C8H5Cl3O3
Vzhled Bělavá až žlutá krystalická pevná látka
Identifikace
SMILES Clc1cc(OCC(=O)O)c(Cl)cc1Cl
InChI 1S/C8H5Cl3O3/c9-4-1-6(11)7(2-5(4)10)14-3-8(12)13/h1-2H,3H2,(H,12,13)
1/C8H5Cl3O3/c9-4-1-6(11)7(2-5(4)10)14-3-8(12)13/h1-2H,3H2,(H,12,13)
Číslo RTECS AJ8400000
Vlastnosti
Molární hmotnost 255,48 g/mol
Teplota tání 154-158°C
Hustota 1,80 g/cm3 (20°C)
Rozpustnost ve vodě 0,023 8 g/100 ml (30 °C)
Struktura
Bezpečnost
R-věty S22, S36, S37, S38, S50, S53
S-věty S24, S60, S61
NFPA 704
NFPA 704.svg
?
4
?
BIO
Není-li uvedeno jinak, jsou použity jednotky
SI a STP (25 °C, 100 kPa).

Kyselina trichlorfenoxyoctová (2,4,5 - T) je organochloridový pesticid, který proslul zejména jako jedna ze složek defoliantu Agent Orange, který byl masově nasazen americkou armádou během války ve Vietnamu.[1]

Vlastnosti[editovat | editovat zdroj]

Jde o látku poměrně silně toxickou pro teplokrevné živočichy. K příznakům otravy 2,4,5-T patří anorexie, průjem a poruchy jater a ledvin.[2]

Výroba a kontaminace Spolany Neratovice[editovat | editovat zdroj]

2,4,5-T se v letech 19651968 vyráběl v chemičce Spolana Neratovice, přičemž jako nežádoucí vedlejší produkty vznikaly velmi toxické dioxiny. Ty způsobily vážné onemocnění desítek zaměstnanců firmy, a proto byla výroba zastavena a kontaminované budovy přes 30 let chátraly.[3]

Reference[editovat | editovat zdroj]

  1. Miroslav Šuta: Agent Orange a Spolana, Literární noviny, č. 24/2008
  2. Jiří Patočka: Vojenská toxikologie, Grada, ISBN 80-247-0608-3
  3. Miroslav Šuta: Spolana — časovaná bomba na břehu Labe, Sedmá generace, 10/2002

Externí odkazy[editovat | editovat zdroj]