Mevinfos

Z Wikipedie, otevřené encyklopedie
Skočit na: Navigace, Hledání
Mevinfos
Mevinphos E,Z Isomers Formulae V.1.svg
Obecné
Systematický název 2-methoxykarbonyl-1-methylvinyl dimethyl fosfát
Triviální název mevinfos
Anglický název Mevinphos
Německý název Mevinphos
Sumární vzorec C7H13O6P
Vzhled bezbarvá kapalina[1]
Identifikace
SMILES CC(=CC(=O)OC)OP(=O)(OC)OC
Vlastnosti
Molární hmotnost 224,15 g/mol
Teplota varu 21 °C (E izomer), 6,9 °C (Z izomer)
Bezpečnost
NFPA 704
Není-li uvedeno jinak, jsou použity jednotky
SI a STP (25 °C, 100 kPa).

Mevinfos (systematický název 2-methoxykarbonyl-1-methylvinyl dimethyl fosfát) je organofosfátový insekticid a akaricid se sumárním vzorcem C7H13O6P.
Jedná se o inhibitor acetylcholinesterázy používaný k hubení hmyzu na velkém množství různých plodin.
LD50 pro krysy činí 3,7–7 mg/kg (orálně).[1]

Použití[editovat | editovat zdroj]

Mevinfos je nejvíce používán na hubení žvýkajícího a sajícího hmyzu a roztočů Tetranychidae.[1]

Výroba[editovat | editovat zdroj]

Mevinfos je vyráběn reakcí trimethoxyfosfinu s chloracetacetátem.

Reference[editovat | editovat zdroj]

V tomto článku byl použit překlad textu z článku Mevinphos na anglické Wikipedii.

  1. a b c (2000)in Muller, Franz: Agrochemicals: Composition, Production, Toxicology, Applications.Toronto:Wiley-VCH. ISBN 3-527-29852-5.