Sapotalin

Z Wikipedie, otevřené encyklopedie
Skočit na: Navigace, Hledání
Sapotalin
Strukturní vzorec
Obecné
Systematický název 1,2,7-trimethylnaftalen
Anglický název 1,2,7-trimethylnaphthalene (systematický název),
sapotalin
Německý název Sapotalin
Sumární vzorec C13H14
Identifikace
SMILES CC1=CC2=C(C=C1)C=CC(=C2C)C
Vlastnosti
Molární hmotnost 170,25 g/mol
Teplota tání -42 °C
Teplota varu 115,3 °C
Hustota 0,987 g/cm3
Bezpečnost
NFPA 704
Není-li uvedeno jinak, jsou použity jednotky
SI a STP (25 °C, 100 kPa).

Sapotalin (systematický název 1,2,7-trimethylnaftalen) je kapalný bezbarvý polyaromatický uhlovodík štiplavého zápachu, s dvěma benzenovými jádry, v podstatě trimethylderivát naftalenu. Hoří žlutým plamenem. Je zdraví škodlivý.

Reference[editovat | editovat zdroj]

V tomto článku byl použit překlad textu z článku Sapotalin na anglické Wikipedii.