Octan zinečnatý

Z Wikipedie, otevřené encyklopedie
Skočit na: Navigace, Hledání
Octan zinečnatý
Krystaly octanu zinečnatého
Systematický název ethanoát zinečnatý
Triviální název octan zinečnatý
Anglický název Zinc acetate
Německý název Zinkacetat
Funkční vzorec (CH3COO)2Zn, (CH3COO)2Zn.2 H2O (dihydrát)
Sumární vzorec C4H6O4Zn, C4H10O6Zn (dihydrát)
Vzhled bílá pevná látka
SMILES [Zn+2].[O-]C(=O)C.[O-]C(=O)C
InChI 1S/2C2H4O2.Zn/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2
Číslo RTECS ZG8750000
Molární hmotnost 183,48 g/mol (bezvodý)

219,50 g/mol (dihydrát)

Teplota tání 237 °C (dihydrát přechází na bezvodou formu při 100 °C)
Teplota varu rozklad
Hustota 1,735 g/cm3 (dihydrát)
Rozpustnost ve vodě 43 g/100 ml (20 °C, dihydrát)
Rozpustnost v polárních
rozpustný v ethanolu
NFPA 704
Teplota vzplanutí nehořlavý
Není-li uvedeno jinak, jsou použity jednotky
SI a STP (25 °C, 100 kPa).

Octan zinečnatý (CH3COO)2Zn), systematický název ethanoát zinečnatý je organická sloučenina, zinečnatá sůl kyseliny octové. Vytváří tetraedrické molekuly. Je mírně toxický.

Použití[editovat | editovat zdroj]

Octan zinečnatý se používá v chemické syntéze a jako přídavná látka do potravin, kde se označuje jako E650. Mimo jiné se používá do žvýkaček.[1]

Průmyslové použití[editovat | editovat zdroj]

V průmyslu se octan zinečnatý používá k impregnaci dřeva, výrobě ostatních zinečnatých solí, polymerů a ethylenacetátu.

Podobné sloučeniny[editovat | editovat zdroj]

Reference[editovat | editovat zdroj]

V tomto článku byl použit překlad textu z článku Zinc acetate na anglické Wikipedii.

  1. Giertsen E, Svatun B, Saxton A(February 1987)."Plaque inhibition by hexetidine and zinc". Scand J Dent Res95(1): 49–54. PMID 3470899.