Trimekain

Z Wikipedie, otevřené encyklopedie
Skočit na: Navigace, Hledání
Trimekain
Strukturní vzorec trimekainu
Obecné
Systematický název (2,4,6-trimethylfenylkarbamoylmethyl)
diethylamoniumchlorid
Ostatní názvy N2,N2-diethyl-N-mesitylglycinamid
Latinský název Trimecaini hydrochloridum
Anglický název Trimecaine
Sumární vzorec C15H25ClN2O
Vzhled bílý krystalický prášek
Identifikace
SMILES CCN(CC)CC(=O)NC1=C(C=C(C=C1C)C)C
Vlastnosti
Molární hmotnost 248,363 86 g/mol
NFPA 704
Není-li uvedeno jinak, jsou použity jednotky
SI a STP (25 °C, 100 kPa).

Trimekain (lat. trimecaini hydrochloridum, systematický název (2,4,6-trimethylfenylkarbamoylmethyl)diethylamoniumchlorid, sumární vzorec C15H25ClN2O) je organická sloučenina používaná jako lokální anestetikum a srdeční antiarytmikum. Jedná se o bílý krystalický prášek snadno rozpustný ve vodě a ethanolu[1]. Je součástí přípravků prodávaných pod značkami Mesdicain, Mesocain, Mesokain a dalšími[2].

Historie[editovat | editovat zdroj]

Trimekain je pravděpodobně českým objevem (z hlediska komplexního farmakologického a klinického zhodnocení a nasazení do praxe), přestože jeho přípravu již předtím publikoval Löfgren v roce 1946[2].

Mechanismus účinku, farmakokinetika[editovat | editovat zdroj]

Podobně jako další lokální anestetika amidové skupiny, snižuje permeabilitu membrány, způsobuje depolarizaci a zkracuje akční potenciál[3]. Anestetický účinek nastupuje do 15 minut a trvá 60-90 minut. Biologický poločas je cca 90 minut, trimekain se vylučuje z 10 % nezměněn, z 90 % ve formě metabolitů. Prochází hematoencefalickou a placentární bariérou[4].

Indikace[editovat | editovat zdroj]

Trimekain má dvě oblasti použití. Jednou je místní anestezie - topická, infiltrační, regionální, povrchová slizniční a inhalační, spinální a Bierova nitrožilní. Používá se v koncentracích 0,4 až 4 %, v některých případech (např. ve stomatologii) ve směsi s adrenalinem. Druhou oblastí je profylaxe a léčba komorových arytmií při infarktu myokardu a v kardiochirurgii. Používá se také k profylaxi sympatické reakce při tracheální intubaci[3][4].

Kontraindikace[editovat | editovat zdroj]

Trimekain nelze používat při přecitlivělosti na amidová anestetika, hypervolémii, hypotenzi, poruchách srdečního vedení, asystolii, kardiogenním šoku a při maligní hypertermii v anamneze[3][4].

Nežádoucí účinky[editovat | editovat zdroj]

Vzácně se objevují alergické reakce od kožních či slizničních projevů až po anafylaktický šok. Při předávkování nastává toxická reakce - vzrušení, neklid, zmatenost, poruchy vidění, hučení v uších, svalové chvění až třes, v těžších případech spavost, hyporeflexie, poruchy dýchání až apnoe, křeče[3][4].

Související články[editovat | editovat zdroj]

Reference[editovat | editovat zdroj]

  1. Trimecaini hydrochloridum - Český lékopis 1997
  2. a b Trimekain
  3. a b c d Antiarytmika (Novák, M.)
  4. a b c d MESOCAIN - Operativa