Kyselina argininojantarová

Z Wikipedie, otevřené encyklopedie
Skočit na navigaci Skočit na vyhledávání
Kyselina argininojantarová
Strukturní vzorec

Strukturní vzorec

Obecné
Systematický název N-[{[(4S)-4-amino-4-karboxybutyl]amino}(imino)methyl]-(2S)-2-aminobutandiová kyselina
Anglický název Argininosuccinic acid, N-[{[(4S)-4-amino-4-carboxybutyl]amino}(imino)methyl]-L-aspartic acid
Sumární vzorec C10H18N4O6
Identifikace
PubChem
SMILES O=C(O)C[C@@H](C(=O)O)NC(=N/CCC[C@H](N)C(=O)O)/N
InChI 1/C10H18N4O6/c11-5(8(17)18)2-1-3-13-10(12)14-6(9(19)20)4-7(15)16/h5-6H,1-4,11H2,(H,15,16)(H,17,18)(H,19,20)(H3,12,13,14)/t5-,6-/m0/s1
Vlastnosti
Molární hmotnost 290,273 g/mol
Není-li uvedeno jinak, jsou použity
jednotky SI a STP (25 °C, 100 kPa).
Některá data mohou pocházet z datové položky.

Kyselina argininojantarová je neproteinogenní aminokyselina která je meziproduktem v močovinovém cyklu. Patří mezi zásadité aminokyseliny.

Reakce[editovat | editovat zdroj]

Některé buňky vytvářejí kyselinu argininojantarovou z citrulinu a kyseliny asparagové a používají ji jako prekurzor argininu v močovinovém nebo citrulin-NO cyklu. Vznik této kyseliny katalyzuje enzym argininosukcinátsyntetáza.

Kyselina argininojantarová je prekurzorem kyseliny fumarovécitrátovém cyklu, ta vzniká působením argininosukcinátlyázy.

Odkazy[editovat | editovat zdroj]

Související články[editovat | editovat zdroj]

Reference[editovat | editovat zdroj]

V tomto článku byl použit překlad textu z článku Argininosuccinic acid na anglické Wikipedii.