Arabitol

Z Wikipedie, otevřené encyklopedie
Skočit na: Navigace, Hledání
Arabitol
strukturní vzorec
strukturní vzorec
Obecné
Systematický název (2R,4R)-pentan-1,2,3,4,5-pentol (D-izomer)
(2S,4S)-pentan-1,2,3,4,5-pentol (L-izomer)
Anglický název Arabitol
Sumární vzorec C5H12O5
Vzhled bílé krystaly
Identifikace
Registrační číslo CAS
PubChem
ChEBI
SMILES OC[C@@H](O)C(O)[C@H](O)CO
InChI 1S/C5H12O5/c6-1-3(8)5(10)4(9)2-7/h3-10H,1-2H2/t3-,4-/m1/s1
Vlastnosti
Molární hmotnost 152,15 g/mol
Teplota tání 103 °C (376 K)
Rozpustnost ve vodě rozpustný
Není-li uvedeno jinak, jsou použity jednotky
SI a STP (25 °C, 100 kPa).

Arabitol je organická sloučenina patřící mezi cukerné alkoholy. Lze jej vytvořit redukcí arabinózy nebo lyxózy. Existují testy na organické kyseliny, které odhalí přítomnost D-arabitolu v těle, což může značit přemnožení střevních bakterií jako jsou Candida albicans nebo některých kvasinek.[1]

Reference[editovat | editovat zdroj]

V tomto článku byl použit překlad textu z článku Arabitol na anglické Wikipedii.

  1. Archived copy [online]. [cit. 2010-03-16]. [1]. (anglicky)