
Z Wikipedie, otevřené encyklopedie
Skočit na: Navigace, Hledání
Strukturní vzorec estronu
Strukturní vzorec estronu
Systematický název 3-Hydroxyestra-1,3,5(10)-trien-17-on
Triviální název Estron
Anglický název Estrone
Německý název Estron
Sumární vzorec C18H22O2
Vzhled Bezbarvý krystalický
Registrační číslo CAS
SMILES O=C4[C@]3(CC[C@@H]2c1ccc(O)cc1CC[C@H]2[C@@H]3CC4)C
Molární hmotnost 270,36 g/mol
Teplota tání 254,5 °C
Rozpustnost ve vodě Špatně rozpustný
Rozpustnost v polárních
Mírně rozpustnýý v acetonu a dioxanu, nízká rozpustnost v ethanolu a rostlinných olejích
Není-li uvedeno jinak, jsou použity jednotky
SI a STP (25 °C, 100 kPa).

Estron je vedle estriolu a estradiolu jeden z ženských pohlavních hormonů estrogenů.

Produkce estronu[editovat | editovat zdroj]

Estron je produkován vaječníky, jedná se však o cca. 45 %. 5 % je produkováno nadledvinami. Zbývajících 50 % však pochází z jiných zdrojů, především z podkožního tukového vaziva.