Ranunkulin

Z Wikipedie, otevřené encyklopedie
Skočit na navigaci Skočit na vyhledávání
Ranunkulin
Strukturní vzorec

Strukturní vzorec

Obecné
Systematický název
Sumární vzorec C₁₁H₁₆O₈
Identifikace
Registrační číslo CAS
SMILES C1=CC(=O)OC1COC2C(C(C(C(O2)CO)O)O)O
InChI 1S/C11H16O8/c12-3-6-8(14)9(15)10(16)11(19-6)17-4-5-1-2-7(13)18-5/h1-2,5-6,8-12,14-16H,3-4H2/t5-,6+,8+,9-,10+,11+/m0/s1
Vlastnosti
Molární hmotnost 276,084 517 Da
Teplota tání 141–142 °C
Není-li uvedeno jinak, jsou použity
jednotky SI a STP (25 °C, 100 kPa).
Některá data mohou pocházet z datové položky.

Ranunkulin (ranunculin) je nestabilní glykosid odvozený od glukózy, nacházející se v rostlinách čeledi pryskyřníkovité (Ranunculaceae). Při porušení pletiva rostliny se enzymaticky rozloží na glukózu a toxin protoanemonin.[1]

Reference[editovat | editovat zdroj]

V tomto článku byl použit překlad textu z článku Ranunculin na anglické Wikipedii.

  1. Toxicology - Prof. RNDr. Jiří Patočka, DrSc - Ranunculin a protoanemonin, jedovaté cyklické laktony pryskyřníků. toxicology.cz [online]. [cit. 2022-06-09]. Dostupné online.