
Z Wikipedie, otevřené encyklopedie
Skočit na navigaci Skočit na vyhledávání
Schéma chemické struktury
Název (INN) captopril
Název podle IUPAC (2S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]pyrrolidin-2-karboxylová kyselina
Číslo CAS 62571-86-2
Klasifikace ATC C09AA01
ChemSpider ID 40130
PubChem 44093
Sumární vzorec C9H15NO3S
InChI InChI=1S/C9H15NO3S/c1-6(5-14)8(11)10-4-2-3-7(10)9(12)13/h6-7,14H,2-5H2,1H3,(H,12,13)/t6-,7+/m1/s1
Molární hmotnost 217.29
Indikace hypertenze, srdeční selhání
Cesty podání p.o. (ústy)
Biodostupnost 70–75%
Metabolismus jaterní
Vylučování ledvinami
Biologický poločas 1,9 hod.
Další informace
Registrace v ČR ano
Dostupnost v ČR ano
Některá data mohou pocházet z datové položky.

Kaptopril je první ze skupiny inhibitorů ACE (enzymu angiotenzin-konvertázy).