Flubendazol

Z Wikipedie, otevřené encyklopedie
Skočit na navigaci Skočit na vyhledávání
Flubendazol
Schéma chemické struktury
Název (INN) flubendazole (angličtina)
Kódy
Číslo CAS 31430-15-6
ChEMBL ID CHEMBL1454946
ChemSpider ID 32932
PubChem 35802
Chemie
Sumární vzorec C₁₆H₁₂FN₃O₃
SMILES COC(=O)NC1=NC2=C(N1)C=C(C=C2)C(=O)C3=CC=C(C=C3)F
InChI InChI=1S/C16H12FN3O3/c1-23-16(22)20-15-18-12-7-4-10(8-13(12)19-15)14(21)9-2-5-11(17)6-3-9/h2-8H,1H3,(H2,18,19,20,22)
Molární hmotnost 313,086 269 u
Některá data mohou pocházet z datové položky.

Flubendazol (INN), systematický název methyl-N-[6-(4-fluorbenzoyl)-1H-benzimidazol-2-yl]karbamát, je organická sloučenina používaná jako anthelmintikum. Je znám například pod obchodním názvem Flutelmium (výrobce Janssen Pharmaceutica) jako veterinární léčivo proti vnitřním parazitům u psů a koček. Mezi další obchodní názvy patří Flubenol, Biovermin nebo Flumoxal.[1]

Reference[editovat | editovat zdroj]

V tomto článku byl použit překlad textu z článku Flubendazole na anglické Wikipedii.

  1. US Patent 5824336 - Chewable flubendazole tablets for companion animals. www.patentstorm.us [online]. [cit. 09-06-2011]. Dostupné v archivu pořízeném dne 12-06-2011.