Karfentanil

Z Wikipedie, otevřené encyklopedie
Skočit na navigaci Skočit na vyhledávání
karfentanil
Schéma chemické struktury
Název (INN) carfentanil (angličtina)
Kódy
Číslo CAS 59708-52-0
ChEMBL ID CHEMBL290429
ChemSpider ID 55986
PubChem 62156
Chemie
Sumární vzorec C₂₄H₃₀N₂O₃ a C24H30N2O3
SMILES CCC(=O)N(C1=CC=CC=C1)C2(CCN(CC2)CCC3=CC=CC=C3)C(=O)OC
InChI InChI=1S/C24H30N2O3/c1-3-22(27)26(21-12-8-5-9-13-21)24(23(28)29-2)15-18-25(19-16-24)17-14-20-10-6-4-7-11-20/h4-13H,3,14-19H2,1-2H3
Molární hmotnost 394,225 643 u
Některá data mohou pocházet z datové položky.

Karfentanil (anglicky carfentanil, systematický název methyl-1-(2-fenylethyl)-4-[fenyl(propanoyl)amino]piperidin-4-karboxylát) je analgetikum morfinové třídy, anilidového typu. Má přibližně 10 000× silnější analgetický účinek než morfin. Pro humánní účely nemá využití, je určen k imobilizaci velkých zvířat (např. před transportem). Obvyklé dávkování je 10 mg/6 t (slon).