
Z Wikipedie, otevřené encyklopedie
Skočit na navigaci Skočit na vyhledávání
Schéma chemické struktury
Název (INN) Clomethiazol
Název podle IUPAC 5-(2-Chloroethyl)-4-methyl-1,3-thiazole
Číslo CAS 533-45-9
Klasifikace ATC N05CM02
ChemSpider ID 10327
PubChem 10783
Sumární vzorec C6H8ClNS1 C6H8ClNS
InChI InChI=1S/C6H8ClNS/c1-5-6(2-3-7)9-4-8-5/h4H,2-3H2,1H3
Molární hmotnost 161.653 g/mol
Další informace
Registrace v ČR ano
Dostupnost v ČR na lékařský předpis
Některá data mohou pocházet z datové položky.

Clomethiazol, též klomethiazol, je lék patřící do skupiny označované jako psychofarmaka. Je to lék používaný k léčbě závislostí, především při závislosti na alkoholu, podání tohoto léku je často život zachraňujícím úkonem při abstinenčním záchvatu nazývaném delirium tremens.

Externí odkazy[editovat | editovat zdroj]