Síran cesný

Z Wikipedie, otevřené encyklopedie
Skočit na navigaci Skočit na vyhledávání
Síran cesný
Obecné
Systematický název Síran cesný
Anglický název Cesium sulfate
Sumární vzorec Cs2SO4
Vzhled bílá pevná látka
Identifikace
Registrační číslo CAS
EC-no (EINECS/ELINCS/NLP) 233-662-6
SMILES [Cs+].[Cs+].[O-]S([O-])(=O)=O
InChI 1/2Cs.H2O4S/c;;1-5(2,3)4/h;;(H2,1,2,3,4)/q2*+1;/p-2
Vlastnosti
Molární hmotnost 361,87 g/mol
Rozpustnost ve vodě 167 g/100 ml (0 °C)
Rozpustnost v polárních
rozpouštědlech
nerozpustný v ethanolu a acetonu
Měrná magnetická susceptibilita -3,21×105 μm3/g
Není-li uvedeno jinak, jsou použity
jednotky SI a STP (25 °C, 100 kPa).
Některá data mohou pocházet z datové položky.

Síran cesný je anorganická sloučenina, cesná sůl kyseliny sírové. Používá se na přípravu hustých roztoků pro diferenciální odstřeďování. Má stejnou strukturu jako síran draselný.

Reference[editovat | editovat zdroj]

V tomto článku byl použit překlad textu z článku Caesium sulfate na anglické Wikipedii.