
Z Wikipedie, otevřené encyklopedie
Skočit na navigaci Skočit na vyhledávání
Schéma chemické struktury
Název (INN) pyrantel (angličtina)
Číslo CAS 15686-83-6
ChemSpider ID 618121
PubChem 708857
Sumární vzorec C₁₁H₁₄N₂S
InChI InChI=1S/C11H14N2S/c1-13-8-3-7-12-11(13)6-5-10-4-2-9-14-10/h2,4-6,9H,3,7-8H2,1H3/b6-5+
Molární hmotnost 206,087 769 u
Indikace ancylostomiasis, trichuriasis, askarióza a enterobiasis
Některá data mohou pocházet z datové položky.

Pyrantel (pyrantelum pamoatum) je léčivá látka patřící do skupiny pyrimidinů. Působí jako anthelmintikum. Je účinný proti střevním hlísticím rodů Toxocara, Toxascaris, Ancylostoma a Uncinaria. Působí především na dospělé a nebo juvenilní červy ve střevě, naopak nepůsobí na migrující larvy. Mechanismus účinku spočívá v tom, že se váže na nervové receptory hlístic a vyvolává tak jejich spastickou paralýzu (ochromení) a následné samovolné vypuzení střevem z hostitele. Je používán samostatně (např. Banminth pasta®) nebo častěji v kombinaci s jiným anthelmintikem (např. Drontal Plus®, Helm-Ex®, Caniverm®).