Fenacetin

Z Wikipedie, otevřené encyklopedie
Skočit na navigaci Skočit na vyhledávání
Fenacetin
Schéma chemické struktury
Název (INN) fenacetin
Název podle IUPAC N-(4-ethoxyfenyl)acetamid
Další názvy p-ethoxyacetanilid
Kódy
Číslo CAS 62-44-2
Klasifikace ATC N02BE03
ChEMBL ID CHEMBL16073
ChemSpider ID 4590
PubChem 4754
Chemie
Sumární vzorec C₁₀H₁₃NO₂
SMILES CCOC1=CC=C(C=C1)NC(=O)C
InChI InChI=1S/C10H13NO2/c1-3-13-10-6-4-9(5-7-10)11-8(2)12/h4-7H,3H2,1-2H3,(H,11,12)
Molární hmotnost 179,094 629 u
Teplota tání 137,5 °C[1]
Farmakologie
Indikace přehřátí organismu a bolest
Některá data mohou pocházet z datové položky.

Fenacetin (systematickým názvem N-(4-ethoxyfenyl)acetamid) je bílá, krystalická látka, derivát acetanilidu. Má dlouhou historii využití v medicíně.

Syntéza[editovat | editovat zdroj]

Syntéza fenacetinu

Jedna z možných syntéz fenacetinu je kondenzace p-nitrofenolu v roztoku hydroxidu sodného s ethylbromidem, v další fázi následována redukcí sulfidem sodným a acetylací anhydridem kyseliny octové[1] (viz obrázek).

Využití[editovat | editovat zdroj]

Fenacetin se využívá v medicíně jako analgetikum a antipyretikum pro lidské i zvířecí subjekty již od roku 1887. Pacienti, hojně užívající fenacetin, měli zvýšené riziko výskytu rakoviny. Následnými studiemi bylo potvrzeno, že fenacetin je karcinogenní. Z tohoto důvodu byl fenacetin stažen z volně prodejných léčiv v mnoha zemích včetně České republiky.[1]

Odkazy[editovat | editovat zdroj]

Reference[editovat | editovat zdroj]

  1. a b c PUBCHEM. Phenacetin. pubchem.ncbi.nlm.nih.gov [online]. [cit. 2020-05-19]. Dostupné online. (anglicky)