Ferrocen

Z Wikipedie, otevřené encyklopedie
Skočit na: Navigace, Hledání
Ferrocen
strukturní vzorec
Obecné
Systematický název {{{Systematický název}}}
Sumární vzorec C10H10Fe
Vzhled světle oranžový prášek
Ferrocen
Identifikace
SMILES [cH-]1cccc1.[cH-]1cccc1.[Fe+2]
InChI 1S/2C5H5.Fe/c2*1-2-4-5-3-1;/h2*1-5H;/q2*-1;+2
Vlastnosti
Molární hmotnost 186,04 g/mol
Teplota tání 174 °C
Teplota varu 249 °C
Hustota 1,107 g/cm3 (0 °C)

1,490 g/cm3 (20 °C)

Rozpustnost ve vodě ve vodě nerozpustný, rozpustný ve většině organických rozpouštědel
Bezpečnost
NFPA 704
Není-li uvedeno jinak, jsou použity jednotky
SI a STP (25 °C, 100 kPa).

Ferrocen (C10H10Fe) je organokovová (metallocenová) sloučenina skládající se ze dvou cyklopentadienidových aromatických kruhů, mezi nimiž je koordinováno dvojmocné železo (+II) pentahaptickou vazbou (sendvičová struktura). Poprvé byl připraven roku 1951 reakcí cyklopentadienyl magnesium bromidu s chloridem železitým.

model molekuly

Historie[editovat | editovat zdroj]

V roce 1973 získali Fischer z Mnichovské technické univerzity a Wilkinson Nobelovu cenu za výzkum vlastností ferrocenu.

Příprava[editovat | editovat zdroj]

Poprvé byl připraven roku 1951 reakcí cyklopentadienyl magnesium bromidu (který se připravuje z cyklopentadienu, hořčíku a bromethanu v benzenu) s chloridem železnatým:

2 C5H5MgBr + FeCl2 → Fe(C5H5)2 + MgCl2 + MgBr2.

Další způsoby přípravy jsou:

Fe + 2 C5H6 → Fe(C5H5)2 + H2  nebo

Fe(CO)5 + 2 C5H6 → Fe(C5H5)2 + 5 CO + H2.

Také se připravuje těmito reakcemi:

2 NaC5H5 + FeCl2 → Fe(C5H5)2 + 2 NaCl

FeCl2.4H2O + 2 C5H6 + 2 KOH → Fe(C5H5)2 + 2 KCl + 6 H2O

FeCl2 + Mn(C5H5)2MnCl2 + Fe(C5H5)2.

Použití[editovat | editovat zdroj]

Ferrocen se používá jako netoxická náhrada tetraethylolova.

Reakce[editovat | editovat zdroj]

Ferrocen se spaluje společně s benzinem:

4 (C5H5)2Fe + 53 O2 → 40 CO2 + 20 H2O + 2 Fe2O3.

V tomto článku byl použit překlad textu z článku Ferrocene na anglické Wikipedii.